C18H23N3O2S — CID 98151634
1-[(1R,12S)-15,15-dimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaen-1-yl]-N,N-dimethylmethanesulfonamide (PubChem CID 98151634) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[(1R,12S)-15,15-dimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaen-1-yl]-N,N-dimethylmethanesulfonamide.
| Compound Name | 1-[(1R,12S)-15,15-dimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaen-1-yl]-N,N-dimethylmethanesulfonamide |
|---|---|
| PubChem CID | 98151634 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-[(1R,12S)-15,15-dimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaen-1-yl]-N,N-dimethylmethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)C[C@@]12CC[C@H](c3nc4ccccc4nc31)C2(C)C |
| InChI | InChI=1S/C18H23N3O2S/c1-17(2)12-9-10-18(17,11-24(22,23)21(3)4)16-15(12)19-13-7-5-6-8-14(13)20-16/h5-8,12H,9-11H2,1-4H3/t12-,18+/m1/s1 |
| InChIKey | ZCHORERJIOECOY-XIKOKIGWSA-N |
| XLogP | 2.68 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |