C19H13Cl6NO2 — CID 98152382
(1S,2R,4R,8S,10R,11S)-1,11,12,13,14,14-hexachloro-6-phenyl-6-azatetracyclo[9.2.1.02,10.04,8]tetradec-12-ene-5,7-dione (PubChem CID 98152382) has the molecular formula C19H13Cl6NO2 and a molecular weight of 500.04 g/mol. Its IUPAC name is (1S,2R,4R,8S,10R,11S)-1,11,12,13,14,14-hexachloro-6-phenyl-6-azatetracyclo[9.2.1.02,10.04,8]tetradec-12-ene-5,7-dione.
| Compound Name | (1S,2R,4R,8S,10R,11S)-1,11,12,13,14,14-hexachloro-6-phenyl-6-azatetracyclo[9.2.1.02,10.04,8]tetradec-12-ene-5,7-dione |
|---|---|
| PubChem CID | 98152382 |
| Molecular Formula | C19H13Cl6NO2 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 496.91 |
| IUPAC Name | (1S,2R,4R,8S,10R,11S)-1,11,12,13,14,14-hexachloro-6-phenyl-6-azatetracyclo[9.2.1.02,10.04,8]tetradec-12-ene-5,7-dione |
| SMILES | O=C1[C@H]2C[C@@H]3[C@@H](C[C@H]2C(=O)N1c1ccccc1)[C@]1(Cl)C(Cl)=C(Cl)[C@]3(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C19H13Cl6NO2/c20-13-14(21)18(23)12-7-10-9(6-11(12)17(13,22)19(18,24)25)15(27)26(16(10)28)8-4-2-1-3-5-8/h1-5,9-12H,6-7H2/t9-,10+,11-,12-,17+,18+/m1/s1 |
| InChIKey | MYTYXZIBQKBWLN-MKWZGBROSA-N |
| XLogP | 5.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|