C11H17ClO3 — CID 98152420
(1S,2S,3R,4S,6R)-3-chloro-6-[(2S,4S)-4-methyl-1,3-dioxolan-2-yl]bicyclo[2.2.1]heptan-2-ol (PubChem CID 98152420) has the molecular formula C11H17ClO3 and a molecular weight of 232.71 g/mol. Its IUPAC name is (1S,2S,3R,4S,6R)-3-chloro-6-[(2S,4S)-4-methyl-1,3-dioxolan-2-yl]bicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1S,2S,3R,4S,6R)-3-chloro-6-[(2S,4S)-4-methyl-1,3-dioxolan-2-yl]bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 98152420 |
| Molecular Formula | C11H17ClO3 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (1S,2S,3R,4S,6R)-3-chloro-6-[(2S,4S)-4-methyl-1,3-dioxolan-2-yl]bicyclo[2.2.1]heptan-2-ol |
| SMILES | C[C@H]1CO[C@H]([C@@H]2C[C@@H]3C[C@@H]2[C@H](O)[C@@H]3Cl)O1 |
| InChI | InChI=1S/C11H17ClO3/c1-5-4-14-11(15-5)8-3-6-2-7(8)10(13)9(6)12/h5-11,13H,2-4H2,1H3/t5-,6-,7-,8+,9+,10-,11-/m0/s1 |
| InChIKey | ALRFFJGNNDCJFL-QSJIWTKBSA-N |
| XLogP | 1.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|