C11H13N3O2S — CID 98152529
2-[[(1S,2R,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]sulfanyl]-1H-pyrimidin-6-one (PubChem CID 98152529) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-[[(1S,2R,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]sulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[[(1S,2R,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]sulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 98152529 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-[[(1S,2R,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]sulfanyl]-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(S[C@H]2/C(=N\O)[C@H]3CC[C@H]2C3)[nH]1 |
| InChI | InChI=1S/C11H13N3O2S/c15-8-3-4-12-11(13-8)17-10-7-2-1-6(5-7)9(10)14-16/h3-4,6-7,10,16H,1-2,5H2,(H,12,13,15)/b14-9-/t6-,7-,10+/m0/s1 |
| InChIKey | NRCNEDGJAOISFU-YDWNFNDKSA-N |
| XLogP | 1.49 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|