C10H14Cl2O3 — CID 98153394
1,3-dichloropropan-2-yl (1S,3R,6S)-7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 98153394) has the molecular formula C10H14Cl2O3 and a molecular weight of 253.12 g/mol. Its IUPAC name is 1,3-dichloropropan-2-yl (1S,3R,6S)-7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | 1,3-dichloropropan-2-yl (1S,3R,6S)-7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 98153394 |
| Molecular Formula | C10H14Cl2O3 |
| Molecular Weight | 253.12 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 1,3-dichloropropan-2-yl (1S,3R,6S)-7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | O=C(OC(CCl)CCl)[C@@H]1CC[C@@H]2O[C@H]2C1 |
| InChI | InChI=1S/C10H14Cl2O3/c11-4-7(5-12)14-10(13)6-1-2-8-9(3-6)15-8/h6-9H,1-5H2/t6-,8+,9+/m1/s1 |
| InChIKey | ZKAXUXCPSXXOQE-YEPSODPASA-N |
| XLogP | 1.94 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.12 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|