C14H18N2O2S — CID 98153705
(1R,5R)-1,8,8-trimethyl-3-(5-methyl-1,3-thiazol-2-yl)-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 98153705) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is (1R,5R)-1,8,8-trimethyl-3-(5-methyl-1,3-thiazol-2-yl)-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5R)-1,8,8-trimethyl-3-(5-methyl-1,3-thiazol-2-yl)-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 98153705 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (1R,5R)-1,8,8-trimethyl-3-(5-methyl-1,3-thiazol-2-yl)-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | Cc1cnc(N2C(=O)[C@@H]3CC[C@@](C)(C2=O)C3(C)C)s1 |
| InChI | InChI=1S/C14H18N2O2S/c1-8-7-15-12(19-8)16-10(17)9-5-6-14(4,11(16)18)13(9,2)3/h7,9H,5-6H2,1-4H3/t9-,14-/m0/s1 |
| InChIKey | QXQDAVQIAILCAO-XPTSAGLGSA-N |
| XLogP | 2.77 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|