C27H15N3O3 — CID 981540
6-methyl-17-phenyl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione (PubChem CID 981540) has the molecular formula C27H15N3O3 and a molecular weight of 429.44 g/mol. Its IUPAC name is 6-methyl-17-phenyl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione.
| Compound Name | 6-methyl-17-phenyl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
|---|---|
| PubChem CID | 981540 |
| Molecular Formula | C27H15N3O3 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 6-methyl-17-phenyl-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
| SMILES | Cc1ccc2c(c1)nc1c3ccc4c5c(ccc(c(=O)n21)c53)C(=O)N(c1ccccc1)C4=O |
| InChI | InChI=1S/C27H15N3O3/c1-14-7-12-21-20(13-14)28-24-16-8-9-18-23-19(11-10-17(22(16)23)27(33)30(21)24)26(32)29(25(18)31)15-5-3-2-4-6-15/h2-13H,1H3 |
| InChIKey | MSPMFKXCSQQYKF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|