C24H32N2O2 — CID 98155306
1-N-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-3-N-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]benzene-1,3-dicarboxamide (PubChem CID 98155306) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is 1-N-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-3-N-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-3-N-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 98155306 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 1-N-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-3-N-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]benzene-1,3-dicarboxamide |
| SMILES | O=C(NC[C@@H]1C[C@@H]2CC[C@@H]1C2)c1cccc(C(=O)NC[C@@H]2C[C@H]3CC[C@@H]2C3)c1 |
| InChI | InChI=1S/C24H32N2O2/c27-23(25-13-21-10-15-4-6-17(21)8-15)19-2-1-3-20(12-19)24(28)26-14-22-11-16-5-7-18(22)9-16/h1-3,12,15-18,21-22H,4-11,13-14H2,(H,25,27)(H,26,28)/t15-,16+,17-,18-,21+,22+/m1/s1 |
| InChIKey | RMJCSAXLYAXDGY-KVEFOAQZSA-N |
| XLogP | 4.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |