C17H23N3O2 — CID 98156064
4-[4-[(1R,2R,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]phenol (PubChem CID 98156064) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-[4-[(1R,2R,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[(1R,2R,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 98156064 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 4-[4-[(1R,2R,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]phenol |
| SMILES | O/N=C1\[C@H]2CC[C@H](C2)[C@H]1N1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C17H23N3O2/c21-15-5-3-14(4-6-15)19-7-9-20(10-8-19)17-13-2-1-12(11-13)16(17)18-22/h3-6,12-13,17,21-22H,1-2,7-11H2/b18-16+/t12-,13+,17+/m0/s1 |
| InChIKey | YQVVRRCDYXUSPE-MNYSTJCXSA-N |
| XLogP | 2.14 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|