C11H14N4O — CID 98156072
2-[cyanomethyl-[(1R,2S,3E,4R)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]amino]acetonitrile (PubChem CID 98156072) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[cyanomethyl-[(1R,2S,3E,4R)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-[(1R,2S,3E,4R)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]amino]acetonitrile |
|---|---|
| PubChem CID | 98156072 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-[cyanomethyl-[(1R,2S,3E,4R)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]amino]acetonitrile |
| SMILES | N#CCN(CC#N)[C@@H]1/C(=N/O)[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C11H14N4O/c12-3-5-15(6-4-13)11-9-2-1-8(7-9)10(11)14-16/h8-9,11,16H,1-2,5-7H2/b14-10+/t8-,9-,11+/m1/s1 |
| InChIKey | HIBBLMZYDSIZLI-AVWKOVAESA-N |
| XLogP | 0.96 |
| TPSA | 83.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|