C10H15NO3S — CID 98156200
methyl 2-[[(1S,2S,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]sulfanyl]acetate (PubChem CID 98156200) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is methyl 2-[[(1S,2S,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]sulfanyl]acetate.
| Compound Name | methyl 2-[[(1S,2S,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]sulfanyl]acetate |
|---|---|
| PubChem CID | 98156200 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | methyl 2-[[(1S,2S,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]sulfanyl]acetate |
| SMILES | COC(=O)CS[C@@H]1/C(=N/O)[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C10H15NO3S/c1-14-8(12)5-15-10-7-3-2-6(4-7)9(10)11-13/h6-7,10,13H,2-5H2,1H3/b11-9+/t6-,7-,10-/m0/s1 |
| InChIKey | GDBLDDLRTLLQRP-LJEKWJGNSA-N |
| XLogP | 1.52 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|