C10H13N3OS2 — CID 98156288
(NE)-N-[(1S,3R,4R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 98156288) has the molecular formula C10H13N3OS2 and a molecular weight of 255.37 g/mol. Its IUPAC name is (NE)-N-[(1S,3R,4R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1S,3R,4R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 98156288 |
| Molecular Formula | C10H13N3OS2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | (NE)-N-[(1S,3R,4R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | Cc1nnc(S[C@H]2/C(=N/O)[C@H]3CC[C@@H]2C3)s1 |
| InChI | InChI=1S/C10H13N3OS2/c1-5-11-12-10(15-5)16-9-7-3-2-6(4-7)8(9)13-14/h6-7,9,14H,2-4H2,1H3/b13-8+/t6-,7+,9+/m0/s1 |
| InChIKey | BXTDDAZSTPNURI-JFGZZOKESA-N |
| XLogP | 2.57 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|