C9H4Cl6N2O2 — CID 98156451
(1S,2R,7R,8S)-1,8,9,10,11,11-hexachloro-4,5-diazatricyclo[6.2.1.02,7]undec-9-ene-3,6-dione (PubChem CID 98156451) has the molecular formula C9H4Cl6N2O2 and a molecular weight of 384.86 g/mol. Its IUPAC name is (1S,2R,7R,8S)-1,8,9,10,11,11-hexachloro-4,5-diazatricyclo[6.2.1.02,7]undec-9-ene-3,6-dione.
| Compound Name | (1S,2R,7R,8S)-1,8,9,10,11,11-hexachloro-4,5-diazatricyclo[6.2.1.02,7]undec-9-ene-3,6-dione |
|---|---|
| PubChem CID | 98156451 |
| Molecular Formula | C9H4Cl6N2O2 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 381.84 |
| IUPAC Name | (1S,2R,7R,8S)-1,8,9,10,11,11-hexachloro-4,5-diazatricyclo[6.2.1.02,7]undec-9-ene-3,6-dione |
| SMILES | O=C1NNC(=O)[C@H]2[C@H]1[C@]1(Cl)C(Cl)=C(Cl)[C@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C9H4Cl6N2O2/c10-3-4(11)8(13)2-1(5(18)16-17-6(2)19)7(3,12)9(8,14)15/h1-2H,(H,16,18)(H,17,19)/t1-,2-,7+,8+/m1/s1 |
| InChIKey | DIFOGECSJLUEBS-DMSXIQSLSA-N |
| XLogP | 2.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|