C13H23N3O2 — CID 98156703
2-[4-[(1S,2S,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]ethanol (PubChem CID 98156703) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-[4-[(1S,2S,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[(1S,2S,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 98156703 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-[4-[(1S,2S,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN([C@@H]2/C(=N\O)[C@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C13H23N3O2/c17-8-7-15-3-5-16(6-4-15)13-11-2-1-10(9-11)12(13)14-18/h10-11,13,17-18H,1-9H2/b14-12-/t10-,11-,13-/m0/s1 |
| InChIKey | ZFIBVWVOPMQOBT-UIEAIMIQSA-N |
| XLogP | 0.22 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|