C30H24FNO4 — CID 98157546
(1S,2R,6R,7S)-10-[bis(4-methoxyphenyl)methylidene]-4-(4-fluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98157546) has the molecular formula C30H24FNO4 and a molecular weight of 481.52 g/mol. Its IUPAC name is (1S,2R,6R,7S)-10-[bis(4-methoxyphenyl)methylidene]-4-(4-fluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S)-10-[bis(4-methoxyphenyl)methylidene]-4-(4-fluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98157546 |
| Molecular Formula | C30H24FNO4 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | (1S,2R,6R,7S)-10-[bis(4-methoxyphenyl)methylidene]-4-(4-fluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COc1ccc(C(=C2[C@H]3C=C[C@H]2[C@H]2C(=O)N(c4ccc(F)cc4)C(=O)[C@@H]23)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H24FNO4/c1-35-21-11-3-17(4-12-21)25(18-5-13-22(36-2)14-6-18)26-23-15-16-24(26)28-27(23)29(33)32(30(28)34)20-9-7-19(31)8-10-20/h3-16,23-24,27-28H,1-2H3/t23-,24-,27-,28-/m1/s1 |
| InChIKey | HANHVJMVFCUNSI-NFFAYCCRSA-N |
| XLogP | 5.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|