C12H22N4O — CID 98158042
(NE)-N-[(1S,3R,4S)-3-[(4-methylpiperazin-1-yl)amino]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 98158042) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is (NE)-N-[(1S,3R,4S)-3-[(4-methylpiperazin-1-yl)amino]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1S,3R,4S)-3-[(4-methylpiperazin-1-yl)amino]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 98158042 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (NE)-N-[(1S,3R,4S)-3-[(4-methylpiperazin-1-yl)amino]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | CN1CCN(N[C@H]2/C(=N/O)[C@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C12H22N4O/c1-15-4-6-16(7-5-15)13-11-9-2-3-10(8-9)12(11)14-17/h9-11,13,17H,2-8H2,1H3/b14-12+/t9-,10-,11+/m0/s1 |
| InChIKey | QTNHSTRWIPBCKE-MTBNRICRSA-N |
| XLogP | 0.37 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|