C20H18O2 — CID 98158179
(2Z,5R)-2-[(4-methoxyphenyl)methylidene]-3-methyl-5-phenylcyclopent-3-en-1-one (PubChem CID 98158179) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2Z,5R)-2-[(4-methoxyphenyl)methylidene]-3-methyl-5-phenylcyclopent-3-en-1-one.
| Compound Name | (2Z,5R)-2-[(4-methoxyphenyl)methylidene]-3-methyl-5-phenylcyclopent-3-en-1-one |
|---|---|
| PubChem CID | 98158179 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (2Z,5R)-2-[(4-methoxyphenyl)methylidene]-3-methyl-5-phenylcyclopent-3-en-1-one |
| SMILES | COc1ccc(/C=C2\C(=O)[C@@H](c3ccccc3)C=C2C)cc1 |
| InChI | InChI=1S/C20H18O2/c1-14-12-19(16-6-4-3-5-7-16)20(21)18(14)13-15-8-10-17(22-2)11-9-15/h3-13,19H,1-2H3/b18-13-/t19-/m1/s1 |
| InChIKey | KELZEBAUXVZTKJ-CWDSQJGSSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|