C17H15N5O2 — CID 98159255
(1R,3R,5R,8R)-1-ethyl-6-imino-8-methyl-3-pyridin-2-yl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 98159255) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is (1R,3R,5R,8R)-1-ethyl-6-imino-8-methyl-3-pyridin-2-yl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | (1R,3R,5R,8R)-1-ethyl-6-imino-8-methyl-3-pyridin-2-yl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 98159255 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (1R,3R,5R,8R)-1-ethyl-6-imino-8-methyl-3-pyridin-2-yl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\O[C@@]2(CC)O[C@@H](c3ccccn3)C(C#N)(C#N)[C@@]1(C#N)[C@H]2C |
| InChI | InChI=1S/C17H15N5O2/c1-3-17-11(2)16(10-20,14(21)24-17)15(8-18,9-19)13(23-17)12-6-4-5-7-22-12/h4-7,11,13,21H,3H2,1-2H3/b21-14-/t11-,13+,16+,17-/m1/s1 |
| InChIKey | IPNKUMLEOVIXCR-JAGZVEDXSA-N |
| XLogP | 2.45 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|