C26H21BrN4O4S — CID 98159394
2-[4-bromo-2-[(6S)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenoxy]acetic acid (PubChem CID 98159394) has the molecular formula C26H21BrN4O4S and a molecular weight of 565.45 g/mol. Its IUPAC name is 2-[4-bromo-2-[(6S)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-bromo-2-[(6S)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 98159394 |
| Molecular Formula | C26H21BrN4O4S |
| Molecular Weight | 565.45 g/mol |
| Exact Mass | 564.05 |
| IUPAC Name | 2-[4-bromo-2-[(6S)-3-[(4-methylphenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenoxy]acetic acid |
| SMILES | Cc1ccc(CSc2nnc3c(n2)O[C@@H](c2cc(Br)ccc2OCC(=O)O)Nc2ccccc2-3)cc1 |
| InChI | InChI=1S/C26H21BrN4O4S/c1-15-6-8-16(9-7-15)14-36-26-29-25-23(30-31-26)18-4-2-3-5-20(18)28-24(35-25)19-12-17(27)10-11-21(19)34-13-22(32)33/h2-12,24,28H,13-14H2,1H3,(H,32,33)/t24-/m0/s1 |
| InChIKey | BAGRDXAQNXHQDG-DEOSSOPVSA-N |
| XLogP | 5.87 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |