C26H22N4O3 — CID 98160550
(1R,2S,3R,4R)-3-[3-(4-ethylphenyl)-2-oxo-[1,2,4]triazino[2,3-c]quinazolin-6-yl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98160550) has the molecular formula C26H22N4O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-[3-(4-ethylphenyl)-2-oxo-[1,2,4]triazino[2,3-c]quinazolin-6-yl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4R)-3-[3-(4-ethylphenyl)-2-oxo-[1,2,4]triazino[2,3-c]quinazolin-6-yl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98160550 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (1R,2S,3R,4R)-3-[3-(4-ethylphenyl)-2-oxo-[1,2,4]triazino[2,3-c]quinazolin-6-yl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CCc1ccc(-c2nn3c([C@H]4[C@@H](C(=O)O)[C@H]5C=C[C@H]4C5)nc4ccccc4c3nc2=O)cc1 |
| InChI | InChI=1S/C26H22N4O3/c1-2-14-7-9-15(10-8-14)22-25(31)28-23-18-5-3-4-6-19(18)27-24(30(23)29-22)20-16-11-12-17(13-16)21(20)26(32)33/h3-12,16-17,20-21H,2,13H2,1H3,(H,32,33)/t16-,17-,20+,21-/m0/s1 |
| InChIKey | WZAQPLCEYCWYSO-PZBISTMVSA-N |
| XLogP | 3.86 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|