C19H15Br3N4O2S — CID 98160578
2,4,6-tribromo-3-[(6S)-3-propylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol (PubChem CID 98160578) has the molecular formula C19H15Br3N4O2S and a molecular weight of 603.13 g/mol. Its IUPAC name is 2,4,6-tribromo-3-[(6S)-3-propylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol.
| Compound Name | 2,4,6-tribromo-3-[(6S)-3-propylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol |
|---|---|
| PubChem CID | 98160578 |
| Molecular Formula | C19H15Br3N4O2S |
| Molecular Weight | 603.13 g/mol |
| Exact Mass | 599.85 |
| IUPAC Name | 2,4,6-tribromo-3-[(6S)-3-propylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol |
| SMILES | CCCSc1nnc2c(n1)O[C@@H](c1c(Br)cc(Br)c(O)c1Br)Nc1ccccc1-2 |
| InChI | InChI=1S/C19H15Br3N4O2S/c1-2-7-29-19-24-18-15(25-26-19)9-5-3-4-6-12(9)23-17(28-18)13-10(20)8-11(21)16(27)14(13)22/h3-6,8,17,23,27H,2,7H2,1H3/t17-/m0/s1 |
| InChIKey | WARRGBRHGDXAJR-KRWDZBQOSA-N |
| XLogP | 6.54 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.13 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |