C12H18N2O2 — CID 98162011
(1R,2S,5S,6S)-3,7-dimethyl-3,7-diazatricyclo[4.2.2.22,5]dodecane-4,8-dione (PubChem CID 98162011) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (1R,2S,5S,6S)-3,7-dimethyl-3,7-diazatricyclo[4.2.2.22,5]dodecane-4,8-dione.
| Compound Name | (1R,2S,5S,6S)-3,7-dimethyl-3,7-diazatricyclo[4.2.2.22,5]dodecane-4,8-dione |
|---|---|
| PubChem CID | 98162011 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (1R,2S,5S,6S)-3,7-dimethyl-3,7-diazatricyclo[4.2.2.22,5]dodecane-4,8-dione |
| SMILES | CN1C(=O)[C@@H]2CC[C@H]1[C@@H]1CC[C@@H]2N(C)C1=O |
| InChI | InChI=1S/C12H18N2O2/c1-13-9-5-3-8(11(13)15)10-6-4-7(9)12(16)14(10)2/h7-10H,3-6H2,1-2H3/t7-,8+,9-,10-/m0/s1 |
| InChIKey | UQICOLYMZZOAKR-JXUBOQSCSA-N |
| XLogP | 0.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |