C9H10O2S — CID 98162265
(1R,6R)-1-methyl-9λ6-thiabicyclo[4.2.1]nona-2,4,7-triene 9,9-dioxide (PubChem CID 98162265) has the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. Its IUPAC name is (1R,6R)-1-methyl-9λ6-thiabicyclo[4.2.1]nona-2,4,7-triene 9,9-dioxide.
| Compound Name | (1R,6R)-1-methyl-9λ6-thiabicyclo[4.2.1]nona-2,4,7-triene 9,9-dioxide |
|---|---|
| PubChem CID | 98162265 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | (1R,6R)-1-methyl-9λ6-thiabicyclo[4.2.1]nona-2,4,7-triene 9,9-dioxide |
| SMILES | C[C@@]12C=CC=C[C@H](C=C1)S2(=O)=O |
| InChI | InChI=1S/C9H10O2S/c1-9-6-3-2-4-8(5-7-9)12(9,10)11/h2-8H,1H3/t8-,9-/m1/s1 |
| InChIKey | SOXNSEWHVKFOCH-RKDXNWHRSA-N |
| XLogP | 1.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|