C20H20O2 — CID 98162374
(1R,2S,7R,8R)-10,13-dimethoxypentacyclo[6.6.2.22,7.02,7.09,14]octadeca-4,9,11,13,15,17-hexaene (PubChem CID 98162374) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (1R,2S,7R,8R)-10,13-dimethoxypentacyclo[6.6.2.22,7.02,7.09,14]octadeca-4,9,11,13,15,17-hexaene.
| Compound Name | (1R,2S,7R,8R)-10,13-dimethoxypentacyclo[6.6.2.22,7.02,7.09,14]octadeca-4,9,11,13,15,17-hexaene |
|---|---|
| PubChem CID | 98162374 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (1R,2S,7R,8R)-10,13-dimethoxypentacyclo[6.6.2.22,7.02,7.09,14]octadeca-4,9,11,13,15,17-hexaene |
| SMILES | COc1ccc(OC)c2c1[C@@H]1C=C[C@@H]2[C@]23C=C[C@]12CC=CC3 |
| InChI | InChI=1S/C20H20O2/c1-21-15-7-8-16(22-2)18-14-6-5-13(17(15)18)19-9-3-4-10-20(14,19)12-11-19/h3-8,11-14H,9-10H2,1-2H3/t13-,14-,19-,20+/m0/s1 |
| InChIKey | ZYPWYOGMGZRBNB-WZBLMQSHSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|