C12H16Br4S — CID 98163035
(3R,4R,8S,9R)-3,4,8,9-tetrabromo-12-thiatricyclo[4.4.3.01,6]tridecane (PubChem CID 98163035) has the molecular formula C12H16Br4S and a molecular weight of 511.94 g/mol. Its IUPAC name is (3R,4R,8S,9R)-3,4,8,9-tetrabromo-12-thiatricyclo[4.4.3.01,6]tridecane.
| Compound Name | (3R,4R,8S,9R)-3,4,8,9-tetrabromo-12-thiatricyclo[4.4.3.01,6]tridecane |
|---|---|
| PubChem CID | 98163035 |
| Molecular Formula | C12H16Br4S |
| Molecular Weight | 511.94 g/mol |
| Exact Mass | 507.77 |
| IUPAC Name | (3R,4R,8S,9R)-3,4,8,9-tetrabromo-12-thiatricyclo[4.4.3.01,6]tridecane |
| SMILES | BrC1CC23CSCC2(C[C@H]1Br)C[C@H](Br)[C@H](Br)C3 |
| InChI | InChI=1S/C12H16Br4S/c13-7-1-11-2-9(15)10(16)4-12(11,3-8(7)14)6-17-5-11/h7-10H,1-6H2/t7-,8+,9+,10?,11?,12?/m0/s1 |
| InChIKey | AQSPUIQUKLGURA-WSTLSYOSSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.94 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|