C14H20N4OS — CID 98163044
1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-propan-2-yl-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 98163044) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-propan-2-yl-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-propan-2-yl-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 98163044 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-propan-2-yl-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | CC(C)N(C[C@H]1C[C@H]2C=C[C@H]1C2)C(=O)Nc1nncs1 |
| InChI | InChI=1S/C14H20N4OS/c1-9(2)18(14(19)16-13-17-15-8-20-13)7-12-6-10-3-4-11(12)5-10/h3-4,8-12H,5-7H2,1-2H3,(H,16,17,19)/t10-,11-,12+/m0/s1 |
| InChIKey | OGKGOPOPOMOTCT-SDDRHHMPSA-N |
| XLogP | 2.99 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|