C23H32N2O — CID 98163076
2-(4-methylpiperazin-1-yl)-1-[(5S,7S)-3-phenyl-1-adamantyl]ethanone (PubChem CID 98163076) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-1-[(5S,7S)-3-phenyl-1-adamantyl]ethanone.
| Compound Name | 2-(4-methylpiperazin-1-yl)-1-[(5S,7S)-3-phenyl-1-adamantyl]ethanone |
|---|---|
| PubChem CID | 98163076 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-1-[(5S,7S)-3-phenyl-1-adamantyl]ethanone |
| SMILES | CN1CCN(CC(=O)C23C[C@H]4C[C@H](C2)CC(c2ccccc2)(C4)C3)CC1 |
| InChI | InChI=1S/C23H32N2O/c1-24-7-9-25(10-8-24)16-21(26)23-14-18-11-19(15-23)13-22(12-18,17-23)20-5-3-2-4-6-20/h2-6,18-19H,7-17H2,1H3/t18-,19-,22?,23?/m0/s1 |
| InChIKey | DMXPEFIAODOVFJ-NAMINWQUSA-N |
| XLogP | 3.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |