C14H16O4 — CID 98164151
[(1'S,2'R,3'S,6'S,7'S)-spiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-yl] acetate (PubChem CID 98164151) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is [(1'S,2'R,3'S,6'S,7'S)-spiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-yl] acetate.
| Compound Name | [(1'S,2'R,3'S,6'S,7'S)-spiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-yl] acetate |
|---|---|
| PubChem CID | 98164151 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | [(1'S,2'R,3'S,6'S,7'S)-spiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@H]2[C@@H]1[C@@H]1C=C[C@@H]2C12OCCO2 |
| InChI | InChI=1S/C14H16O4/c1-8(15)18-12-5-2-9-10-3-4-11(13(9)12)14(10)16-6-7-17-14/h2-5,9-13H,6-7H2,1H3/t9-,10+,11+,12+,13-/m1/s1 |
| InChIKey | GXDDVBOKXXNEHU-QNWJLWSRSA-N |
| XLogP | 1.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|