C18H26N2O2 — CID 98165214
1-[[(2R)-1-[(1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-2-yl]methyl]pyrrolidin-2-one (PubChem CID 98165214) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-[[(2R)-1-[(1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-2-yl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[(2R)-1-[(1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-2-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 98165214 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-[[(2R)-1-[(1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-2-yl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C[C@H]1CCCCN1C(=O)[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C18H26N2O2/c21-17-5-3-8-19(17)12-15-4-1-2-9-20(15)18(22)16-11-13-6-7-14(16)10-13/h6-7,13-16H,1-5,8-12H2/t13-,14-,15+,16+/m0/s1 |
| InChIKey | PJOKVFOLMGZFIH-CAOSSQGBSA-N |
| XLogP | 2.20 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|