C13H22N2O — CID 98166105
2-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl-propan-2-ylamino]acetamide (PubChem CID 98166105) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl-propan-2-ylamino]acetamide.
| Compound Name | 2-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl-propan-2-ylamino]acetamide |
|---|---|
| PubChem CID | 98166105 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl-propan-2-ylamino]acetamide |
| SMILES | CC(C)N(CC(N)=O)C[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C13H22N2O/c1-9(2)15(8-13(14)16)7-12-6-10-3-4-11(12)5-10/h3-4,9-12H,5-8H2,1-2H3,(H2,14,16)/t10-,11-,12+/m0/s1 |
| InChIKey | KOQPVXUEPWEELR-SDDRHHMPSA-N |
| XLogP | 1.39 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|