C15H23N3O2S — CID 98166249
N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-methyl-N-propan-2-ylpyrazole-4-sulfonamide (PubChem CID 98166249) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-methyl-N-propan-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-methyl-N-propan-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 98166249 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-methyl-N-propan-2-ylpyrazole-4-sulfonamide |
| SMILES | CC(C)N(C[C@@H]1C[C@H]2C=C[C@H]1C2)S(=O)(=O)c1cnn(C)c1 |
| InChI | InChI=1S/C15H23N3O2S/c1-11(2)18(9-14-7-12-4-5-13(14)6-12)21(19,20)15-8-16-17(3)10-15/h4-5,8,10-14H,6-7,9H2,1-3H3/t12-,13-,14-/m0/s1 |
| InChIKey | RFAQYCULRFSWQJ-IHRRRGAJSA-N |
| XLogP | 2.03 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|