C19H15BrClF3N2OS — CID 98168945
(1R,9S,13S)-4-bromo-10-[4-chloro-3-(trifluoromethyl)phenyl]-9,13-dimethyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione (PubChem CID 98168945) has the molecular formula C19H15BrClF3N2OS and a molecular weight of 491.76 g/mol. Its IUPAC name is (1R,9S,13S)-4-bromo-10-[4-chloro-3-(trifluoromethyl)phenyl]-9,13-dimethyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione.
| Compound Name | (1R,9S,13S)-4-bromo-10-[4-chloro-3-(trifluoromethyl)phenyl]-9,13-dimethyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione |
|---|---|
| PubChem CID | 98168945 |
| Molecular Formula | C19H15BrClF3N2OS |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | (1R,9S,13S)-4-bromo-10-[4-chloro-3-(trifluoromethyl)phenyl]-9,13-dimethyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-11-thione |
| SMILES | C[C@H]1[C@H]2NC(=S)N(c3ccc(Cl)c(C(F)(F)F)c3)[C@@]1(C)Oc1ccc(Br)cc12 |
| InChI | InChI=1S/C19H15BrClF3N2OS/c1-9-16-12-7-10(20)3-6-15(12)27-18(9,2)26(17(28)25-16)11-4-5-14(21)13(8-11)19(22,23)24/h3-9,16H,1-2H3,(H,25,28)/t9-,16+,18-/m0/s1 |
| InChIKey | KWFBIXOCISNGOW-ORCHDJNQSA-N |
| XLogP | 6.30 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|