C26H24O4 — CID 98169198
(5aS,6aR,12aR,13aR)-2,3,9,10-tetramethyl-5a,6,6a,12a,13,13a-hexahydropentacene-5,7,12,14-tetrone (PubChem CID 98169198) has the molecular formula C26H24O4 and a molecular weight of 400.47 g/mol. Its IUPAC name is (5aS,6aR,12aR,13aR)-2,3,9,10-tetramethyl-5a,6,6a,12a,13,13a-hexahydropentacene-5,7,12,14-tetrone.
| Compound Name | (5aS,6aR,12aR,13aR)-2,3,9,10-tetramethyl-5a,6,6a,12a,13,13a-hexahydropentacene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 98169198 |
| Molecular Formula | C26H24O4 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (5aS,6aR,12aR,13aR)-2,3,9,10-tetramethyl-5a,6,6a,12a,13,13a-hexahydropentacene-5,7,12,14-tetrone |
| SMILES | Cc1cc2c(cc1C)C(=O)[C@@H]1C[C@H]3C(=O)c4cc(C)c(C)cc4C(=O)[C@@H]3C[C@@H]1C2=O |
| InChI | InChI=1S/C26H24O4/c1-11-5-15-16(6-12(11)2)24(28)20-10-22-21(9-19(20)23(15)27)25(29)17-7-13(3)14(4)8-18(17)26(22)30/h5-8,19-22H,9-10H2,1-4H3/t19-,20-,21-,22+/m1/s1 |
| InChIKey | UDIRYGOAIRBKNW-YSFYHYPLSA-N |
| XLogP | 4.64 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|