About 2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid
2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid (PubChem CID 981695) has the molecular formula C24H21Cl2N3O3
and a molecular weight of 470.36 g/mol. Its IUPAC name is 2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid |
| PubChem CID | 981695 |
| Molecular Formula | C24H21Cl2N3O3 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1ccc(N2CCN(c3cccc(Cl)c3Cl)CC2)cc1 |
| InChI | InChI=1S/C24H21Cl2N3O3/c25-20-6-3-7-21(22(20)26)29-14-12-28(13-15-29)17-10-8-16(9-11-17)27-23(30)18-4-1-2-5-19(18)24(31)32/h1-11H,12-15H2,(H,27,30)(H,31,32) |
| InChIKey | FSFZXSFZNRCCRC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid?
The IUPAC name of 2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid (CID 981695) is 2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid.
What is the SMILES notation for 2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid?
The canonical SMILES for 2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid is O=C(O)c1ccccc1C(=O)Nc1ccc(N2CCN(c3cccc(Cl)c3Cl)CC2)cc1.
What is the InChIKey of 2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid?
The InChIKey is FSFZXSFZNRCCRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21Cl2N3O3/c25-20-6-3-7-21(22(20)26)29-14-12-28(13-15-29)17-10-8-16(9-11-17)27-23(30)18-4-1-2-5-19(18)24(31)32/h1-11H,12-15H2,(H,27,30)(H,31,32).
What are the key properties of 2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid?
2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid has a molecular weight of 470.36 g/mol, XLogP of 5.27, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]phenyl]carbamoyl]benzoic acid is sourced from PubChem (CID 981695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).