C25H24FN5O3 — CID 98171713
N-[(4-fluorophenyl)methyl]-6-imino-11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 98171713) has the molecular formula C25H24FN5O3 and a molecular weight of 461.50 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-6-imino-11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-6-imino-11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 98171713 |
| Molecular Formula | C25H24FN5O3 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-6-imino-11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(=O)NCc2ccc(F)cc2)cc2c(=O)n3cccc(C)c3nc2n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C25H24FN5O3/c1-15-4-2-10-30-22(15)29-23-20(25(30)33)12-19(21(27)31(23)14-18-5-3-11-34-18)24(32)28-13-16-6-8-17(26)9-7-16/h2,4,6-10,12,18,27H,3,5,11,13-14H2,1H3,(H,28,32)/b27-21+/t18-/m1/s1 |
| InChIKey | YFDZZKHYUKSLGT-BJKXRTFMSA-N |
| XLogP | 2.69 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|