C30H29ClN4O3S — CID 98172149
[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl] (3R)-3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate (PubChem CID 98172149) has the molecular formula C30H29ClN4O3S and a molecular weight of 561.11 g/mol. Its IUPAC name is [(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl] (3R)-3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate.
| Compound Name | [(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl] (3R)-3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate |
|---|---|
| PubChem CID | 98172149 |
| Molecular Formula | C30H29ClN4O3S |
| Molecular Weight | 561.11 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | [(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl] (3R)-3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate |
| SMILES | [H]/N=C(/S[C@@H]1CC(=O)N(c2ccc(OCCC)cc2)C1=O)N1N=C(c2ccc(C)cc2)C[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H29ClN4O3S/c1-3-16-38-24-14-12-23(13-15-24)34-28(36)18-27(29(34)37)39-30(32)35-26(21-8-10-22(31)11-9-21)17-25(33-35)20-6-4-19(2)5-7-20/h4-15,26-27,32H,3,16-18H2,1-2H3/b32-30+/t26-,27-/m1/s1 |
| InChIKey | RMZIZFZZUYWSAX-LFSREASSSA-N |
| XLogP | 6.59 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.11 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|