C21H34O3 — CID 98173114
(6S,7S)-7-[(1R,3S,4S)-3-ethenyl-4-hydroxy-1-methoxy-3-methylhexyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one (PubChem CID 98173114) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (6S,7S)-7-[(1R,3S,4S)-3-ethenyl-4-hydroxy-1-methoxy-3-methylhexyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one.
| Compound Name | (6S,7S)-7-[(1R,3S,4S)-3-ethenyl-4-hydroxy-1-methoxy-3-methylhexyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 98173114 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (6S,7S)-7-[(1R,3S,4S)-3-ethenyl-4-hydroxy-1-methoxy-3-methylhexyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one |
| SMILES | C=C[C@](C)(C[C@@H](OC)[C@]1(C)C2=C(CCC2=O)CC[C@@H]1C)[C@@H](O)CC |
| InChI | InChI=1S/C21H34O3/c1-7-17(23)20(4,8-2)13-18(24-6)21(5)14(3)9-10-15-11-12-16(22)19(15)21/h8,14,17-18,23H,2,7,9-13H2,1,3-6H3/t14-,17-,18+,20+,21+/m0/s1 |
| InChIKey | LECQFYAXBMWBMJ-ZBWGKUOUSA-N |
| XLogP | 4.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|