C20H17ClFN5O5 — CID 98175497
2-[(3aR,6aS)-5-(4-fluorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide (PubChem CID 98175497) has the molecular formula C20H17ClFN5O5 and a molecular weight of 461.84 g/mol. Its IUPAC name is 2-[(3aR,6aS)-5-(4-fluorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[(3aR,6aS)-5-(4-fluorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98175497 |
| Molecular Formula | C20H17ClFN5O5 |
| Molecular Weight | 461.84 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 2-[(3aR,6aS)-5-(4-fluorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(OC)c(NC(=O)CN2N=N[C@@H]3C(=O)N(c4ccc(F)cc4)C(=O)[C@@H]32)cc1Cl |
| InChI | InChI=1S/C20H17ClFN5O5/c1-31-14-8-15(32-2)13(7-12(14)21)23-16(28)9-26-18-17(24-25-26)19(29)27(20(18)30)11-5-3-10(22)4-6-11/h3-8,17-18H,9H2,1-2H3,(H,23,28)/t17-,18+/m0/s1 |
| InChIKey | BWTZQRSECXVRDF-ZWKOTPCHSA-N |
| XLogP | 2.43 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.84 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|