C19H20N2O5 — CID 98177293
4-[4-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]anilino]-4-oxobutanoic acid (PubChem CID 98177293) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-[4-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]anilino]-4-oxobutanoic acid.
| Compound Name | 4-[4-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 98177293 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-[4-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]anilino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1ccc(N2C(=O)[C@@H]3[C@H]4CC[C@@H](C4)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C19H20N2O5/c22-14(7-8-15(23)24)20-12-3-5-13(6-4-12)21-18(25)16-10-1-2-11(9-10)17(16)19(21)26/h3-6,10-11,16-17H,1-2,7-9H2,(H,20,22)(H,23,24)/t10-,11-,16+,17+/m0/s1 |
| InChIKey | VKGITFIUIGCQGE-BNBDDXAPSA-N |
| XLogP | 2.03 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|