C30H41BrN4O4 — CID 98180960
(1S,2R,5S,6R,7R)-6-N-(4-bromophenyl)-3-[3-[butyl(methyl)amino]propyl]-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98180960) has the molecular formula C30H41BrN4O4 and a molecular weight of 601.59 g/mol. Its IUPAC name is (1S,2R,5S,6R,7R)-6-N-(4-bromophenyl)-3-[3-[butyl(methyl)amino]propyl]-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5S,6R,7R)-6-N-(4-bromophenyl)-3-[3-[butyl(methyl)amino]propyl]-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98180960 |
| Molecular Formula | C30H41BrN4O4 |
| Molecular Weight | 601.59 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | (1S,2R,5S,6R,7R)-6-N-(4-bromophenyl)-3-[3-[butyl(methyl)amino]propyl]-2-N-cyclohexyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCCCN(C)CCCN1C(=O)[C@H]2[C@@H](C(=O)Nc3ccc(Br)cc3)[C@H]3C=C[C@@]2(O3)[C@@H]1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C30H41BrN4O4/c1-3-4-17-34(2)18-8-19-35-26(28(37)33-21-9-6-5-7-10-21)30-16-15-23(39-30)24(25(30)29(35)38)27(36)32-22-13-11-20(31)12-14-22/h11-16,21,23-26H,3-10,17-19H2,1-2H3,(H,32,36)(H,33,37)/t23-,24+,25-,26+,30+/m1/s1 |
| InChIKey | QGTPYAFXZQQBLP-SJNNHYBDSA-N |
| XLogP | 4.11 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|