C26H29NO5S — CID 98183049
[(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] (2R)-2-[(1R,2S,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-4-methylsulfanylbutanoate (PubChem CID 98183049) has the molecular formula C26H29NO5S and a molecular weight of 467.59 g/mol. Its IUPAC name is [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] (2R)-2-[(1R,2S,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-4-methylsulfanylbutanoate.
| Compound Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] (2R)-2-[(1R,2S,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 98183049 |
| Molecular Formula | C26H29NO5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] (2R)-2-[(1R,2S,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](C(=O)O[C@@H](C)C(=O)c1ccc(C)cc1)N1C(=O)[C@@H]2[C@@H]3C=C[C@H]([C@H]4C[C@H]34)[C@@H]2C1=O |
| InChI | InChI=1S/C26H29NO5S/c1-13-4-6-15(7-5-13)23(28)14(2)32-26(31)20(10-11-33-3)27-24(29)21-16-8-9-17(19-12-18(16)19)22(21)25(27)30/h4-9,14,16-22H,10-12H2,1-3H3/t14-,16+,17+,18+,19+,20+,21-,22+/m0/s1 |
| InChIKey | HZTXLTZBHYMZJJ-LRPYUNQRSA-N |
| XLogP | 3.28 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|