C25H30N4O3 — CID 98184882
4-[[(3S)-2,5-dioxopyrrolidin-3-yl]methyl]-N-[(2R)-2-(4-phenylpiperazin-1-yl)propyl]benzamide (PubChem CID 98184882) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-[[(3S)-2,5-dioxopyrrolidin-3-yl]methyl]-N-[(2R)-2-(4-phenylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 4-[[(3S)-2,5-dioxopyrrolidin-3-yl]methyl]-N-[(2R)-2-(4-phenylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 98184882 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 4-[[(3S)-2,5-dioxopyrrolidin-3-yl]methyl]-N-[(2R)-2-(4-phenylpiperazin-1-yl)propyl]benzamide |
| SMILES | C[C@H](CNC(=O)c1ccc(C[C@H]2CC(=O)NC2=O)cc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H30N4O3/c1-18(28-11-13-29(14-12-28)22-5-3-2-4-6-22)17-26-24(31)20-9-7-19(8-10-20)15-21-16-23(30)27-25(21)32/h2-10,18,21H,11-17H2,1H3,(H,26,31)(H,27,30,32)/t18-,21+/m1/s1 |
| InChIKey | JQHJDEHVDMZRGK-NQIIRXRSSA-N |
| XLogP | 1.83 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|