About [(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate
[(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate (PubChem CID 98185240) has the molecular formula C18H16FNO4
and a molecular weight of 329.33 g/mol. Its IUPAC name is [(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate.
Molecular Properties
| Compound Name | [(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate |
| PubChem CID | 98185240 |
| Molecular Formula | C18H16FNO4 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate |
| SMILES | COc1ccc2c(c1)NC(=O)[C@H]2OC(=O)CCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FNO4/c1-23-13-7-8-14-15(10-13)20-18(22)17(14)24-16(21)9-4-11-2-5-12(19)6-3-11/h2-3,5-8,10,17H,4,9H2,1H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | FWVVTMMKBGJLDM-KRWDZBQOSA-N |
| XLogP | 3.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate?
The IUPAC name of [(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate (CID 98185240) is [(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate.
What is the SMILES notation for [(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate?
The canonical SMILES for [(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate is COc1ccc2c(c1)NC(=O)[C@H]2OC(=O)CCc1ccc(F)cc1.
What is the InChIKey of [(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate?
The InChIKey is FWVVTMMKBGJLDM-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H16FNO4/c1-23-13-7-8-14-15(10-13)20-18(22)17(14)24-16(21)9-4-11-2-5-12(19)6-3-11/h2-3,5-8,10,17H,4,9H2,1H3,(H,20,22)/t17-/m0/s1.
What are the key properties of [(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate?
[(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate has a molecular weight of 329.33 g/mol, XLogP of 3.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-6-methoxy-2-oxo-1,3-dihydroindol-3-yl] 3-(4-fluorophenyl)propanoate is sourced from PubChem (CID 98185240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).