C14H13N3O3 — CID 98185514
(1R,2S,6S,7R)-4-(6-methoxypyridazin-3-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98185514) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4-(6-methoxypyridazin-3-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-4-(6-methoxypyridazin-3-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98185514 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (1R,2S,6S,7R)-4-(6-methoxypyridazin-3-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COc1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@H]2C=C[C@H]3C2)nn1 |
| InChI | InChI=1S/C14H13N3O3/c1-20-10-5-4-9(15-16-10)17-13(18)11-7-2-3-8(6-7)12(11)14(17)19/h2-5,7-8,11-12H,6H2,1H3/t7-,8-,11-,12-/m0/s1 |
| InChIKey | MSHNXRAUPZEPFG-OSTYVCCYSA-N |
| XLogP | 0.80 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|