C22H19F2NO — CID 98185561
(1S,2E,4E,5S)-2,4-bis[(2-fluorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 98185561) has the molecular formula C22H19F2NO and a molecular weight of 351.40 g/mol. Its IUPAC name is (1S,2E,4E,5S)-2,4-bis[(2-fluorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | (1S,2E,4E,5S)-2,4-bis[(2-fluorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 98185561 |
| Molecular Formula | C22H19F2NO |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (1S,2E,4E,5S)-2,4-bis[(2-fluorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | CN1[C@H]2CC[C@H]1/C(=C\c1ccccc1F)C(=O)/C2=C/c1ccccc1F |
| InChI | InChI=1S/C22H19F2NO/c1-25-20-10-11-21(25)17(13-15-7-3-5-9-19(15)24)22(26)16(20)12-14-6-2-4-8-18(14)23/h2-9,12-13,20-21H,10-11H2,1H3/b16-12+,17-13+/t20-,21-/m0/s1 |
| InChIKey | JDRBRETYDWGKPP-MZCYXTNPSA-N |
| XLogP | 4.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|