C20H21NOS2 — CID 98185589
(1R,2E,4E,5R)-8-methyl-2,4-bis[(3-methylthiophen-2-yl)methylidene]-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 98185589) has the molecular formula C20H21NOS2 and a molecular weight of 355.53 g/mol. Its IUPAC name is (1R,2E,4E,5R)-8-methyl-2,4-bis[(3-methylthiophen-2-yl)methylidene]-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,2E,4E,5R)-8-methyl-2,4-bis[(3-methylthiophen-2-yl)methylidene]-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 98185589 |
| Molecular Formula | C20H21NOS2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (1R,2E,4E,5R)-8-methyl-2,4-bis[(3-methylthiophen-2-yl)methylidene]-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | Cc1ccsc1/C=C1/C(=O)/C(=C/c2sccc2C)[C@H]2CC[C@H]1N2C |
| InChI | InChI=1S/C20H21NOS2/c1-12-6-8-23-18(12)10-14-16-4-5-17(21(16)3)15(20(14)22)11-19-13(2)7-9-24-19/h6-11,16-17H,4-5H2,1-3H3/b14-10+,15-11+/t16-,17-/m1/s1 |
| InChIKey | FUGSVMXVZYTXAZ-XUGLWYKQSA-N |
| XLogP | 4.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|