C16H18N2O4 — CID 98186911
(1R,2R,4S,5R)-N-(4-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 98186911) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (1R,2R,4S,5R)-N-(4-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide.
| Compound Name | (1R,2R,4S,5R)-N-(4-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
|---|---|
| PubChem CID | 98186911 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (1R,2R,4S,5R)-N-(4-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2[C@@H]3[C@@H]4CC[C@H](C4)[C@H]23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H18N2O4/c1-22-10-4-5-11(12(7-10)18(20)21)17-16(19)15-13-8-2-3-9(6-8)14(13)15/h4-5,7-9,13-15H,2-3,6H2,1H3,(H,17,19)/t8-,9-,13-,14+,15?/m1/s1 |
| InChIKey | YPTDBYJLHWDOGN-RTFANVGBSA-N |
| XLogP | 2.83 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|