C25H19N3O6 — CID 98189489
(4E,5R)-4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-5-(3-nitrophenyl)-1-pyridin-2-ylpyrrolidine-2,3-dione (PubChem CID 98189489) has the molecular formula C25H19N3O6 and a molecular weight of 457.44 g/mol. Its IUPAC name is (4E,5R)-4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-5-(3-nitrophenyl)-1-pyridin-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-5-(3-nitrophenyl)-1-pyridin-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98189489 |
| Molecular Formula | C25H19N3O6 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (4E,5R)-4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-5-(3-nitrophenyl)-1-pyridin-2-ylpyrrolidine-2,3-dione |
| SMILES | C=CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3ccccn3)[C@@H]2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H19N3O6/c1-2-14-34-19-11-9-16(10-12-19)23(29)21-22(17-6-5-7-18(15-17)28(32)33)27(25(31)24(21)30)20-8-3-4-13-26-20/h2-13,15,22,29H,1,14H2/b23-21+/t22-/m1/s1 |
| InChIKey | ULANRLUWFSQBFO-HOGKFDNTSA-N |
| XLogP | 4.18 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|