C27H25ClN2O5S2 — CID 98190976
N-[(3aS,6aS)-3-[5-chloro-2-(3-methylphenoxy)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide (PubChem CID 98190976) has the molecular formula C27H25ClN2O5S2 and a molecular weight of 557.09 g/mol. Its IUPAC name is N-[(3aS,6aS)-3-[5-chloro-2-(3-methylphenoxy)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(3aS,6aS)-3-[5-chloro-2-(3-methylphenoxy)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98190976 |
| Molecular Formula | C27H25ClN2O5S2 |
| Molecular Weight | 557.09 g/mol |
| Exact Mass | 556.09 |
| IUPAC Name | N-[(3aS,6aS)-3-[5-chloro-2-(3-methylphenoxy)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)/N=C2\S[C@@H]3CS(=O)(=O)C[C@@H]3N2c2cc(Cl)ccc2Oc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C27H25ClN2O5S2/c1-17-4-3-5-21(12-17)35-24-11-8-19(28)14-22(24)30-23-15-37(32,33)16-25(23)36-27(30)29-26(31)13-18-6-9-20(34-2)10-7-18/h3-12,14,23,25H,13,15-16H2,1-2H3/b29-27-/t23-,25+/m0/s1 |
| InChIKey | AVCXBACZEISYCV-WADNUHNVSA-N |
| XLogP | 5.29 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.09 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|