C26H31N3O4 — CID 981916
trans-(1S,2S)-2-[[2-[4-(4-methylphenyl)piperazine-1-carbonyl]phenyl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 981916) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is trans-(1S,2S)-2-[[2-[4-(4-methylphenyl)piperazine-1-carbonyl]phenyl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-[[2-[4-(4-methylphenyl)piperazine-1-carbonyl]phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 981916 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | trans-(1S,2S)-2-[[2-[4-(4-methylphenyl)piperazine-1-carbonyl]phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(N2CCN(C(=O)c3ccccc3NC(=O)[C@H]3CCCC[C@@H]3C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C26H31N3O4/c1-18-10-12-19(13-11-18)28-14-16-29(17-15-28)25(31)22-8-4-5-9-23(22)27-24(30)20-6-2-3-7-21(20)26(32)33/h4-5,8-13,20-21H,2-3,6-7,14-17H2,1H3,(H,27,30)(H,32,33)/t20-,21-/m0/s1 |
| InChIKey | KYFPEIQDXBUNJO-SFTDATJTSA-N |
| XLogP | 3.79 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|